C23H31ClN2O3S — CID 91669904
1-(3-chloro-4-methylphenyl)-4-(2-ethoxy-4-methyl-5-propan-2-ylphenyl)sulfonylpiperazine (PubChem CID 91669904) has the molecular formula C23H31ClN2O3S and a molecular weight of 451.03 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-4-(2-ethoxy-4-methyl-5-propan-2-ylphenyl)sulfonylpiperazine.
| Compound Name | 1-(3-chloro-4-methylphenyl)-4-(2-ethoxy-4-methyl-5-propan-2-ylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 91669904 |
| Molecular Formula | C23H31ClN2O3S |
| Molecular Weight | 451.03 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-4-(2-ethoxy-4-methyl-5-propan-2-ylphenyl)sulfonylpiperazine |
| SMILES | CCOc1cc(C)c(C(C)C)cc1S(=O)(=O)N1CCN(c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C23H31ClN2O3S/c1-6-29-22-13-18(5)20(16(2)3)15-23(22)30(27,28)26-11-9-25(10-12-26)19-8-7-17(4)21(24)14-19/h7-8,13-16H,6,9-12H2,1-5H3 |
| InChIKey | AUHDMHCUJAZDES-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.03 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |