C20H25ClN2O3S — CID 91669996
1-(3-chloro-2-methylphenyl)-4-(5-ethyl-2-methoxyphenyl)sulfonylpiperazine (PubChem CID 91669996) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-4-(5-ethyl-2-methoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-4-(5-ethyl-2-methoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 91669996 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-4-(5-ethyl-2-methoxyphenyl)sulfonylpiperazine |
| SMILES | CCc1ccc(OC)c(S(=O)(=O)N2CCN(c3cccc(Cl)c3C)CC2)c1 |
| InChI | InChI=1S/C20H25ClN2O3S/c1-4-16-8-9-19(26-3)20(14-16)27(24,25)23-12-10-22(11-13-23)18-7-5-6-17(21)15(18)2/h5-9,14H,4,10-13H2,1-3H3 |
| InChIKey | ZDYHYPWCMZNSCM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |