C14H19N3O — CID 91670642
2,2,4,6-tetramethyl-1H-quinoline-8-carbohydrazide (PubChem CID 91670642) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2,2,4,6-tetramethyl-1H-quinoline-8-carbohydrazide.
| Compound Name | 2,2,4,6-tetramethyl-1H-quinoline-8-carbohydrazide |
|---|---|
| PubChem CID | 91670642 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2,2,4,6-tetramethyl-1H-quinoline-8-carbohydrazide |
| SMILES | CC1=CC(C)(C)Nc2c(C(=O)NN)cc(C)cc21 |
| InChI | InChI=1S/C14H19N3O/c1-8-5-10-9(2)7-14(3,4)16-12(10)11(6-8)13(18)17-15/h5-7,16H,15H2,1-4H3,(H,17,18) |
| InChIKey | RVAZCYLWCCJMBM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|