C15H14N2OS — CID 916713
N-(naphthalen-1-ylcarbamothioyl)cyclopropanecarboxamide (PubChem CID 916713) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is N-(naphthalen-1-ylcarbamothioyl)cyclopropanecarboxamide.
| Compound Name | N-(naphthalen-1-ylcarbamothioyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 916713 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(naphthalen-1-ylcarbamothioyl)cyclopropanecarboxamide |
| SMILES | O=C(NC(=S)Nc1cccc2ccccc12)C1CC1 |
| InChI | InChI=1S/C15H14N2OS/c18-14(11-8-9-11)17-15(19)16-13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11H,8-9H2,(H2,16,17,18,19) |
| InChIKey | JCMPXNKQVJKZKS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|