About (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate
(4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate (PubChem CID 9167143) has the molecular formula C18H20N2O6S
and a molecular weight of 392.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate |
| PubChem CID | 9167143 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)OCc2ccc([N+](=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C18H20N2O6S/c1-13-3-8-17(11-14(13)2)27(24,25)19-10-9-18(21)26-12-15-4-6-16(7-5-15)20(22)23/h3-8,11,19H,9-10,12H2,1-2H3 |
| InChIKey | LWNFRGAQWRUAMC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate?
The IUPAC name of (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate (CID 9167143) is (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate.
What is the SMILES notation for (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate?
The canonical SMILES for (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate is Cc1ccc(S(=O)(=O)NCCC(=O)OCc2ccc([N+](=O)[O-])cc2)cc1C.
What is the InChIKey of (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate?
The InChIKey is LWNFRGAQWRUAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O6S/c1-13-3-8-17(11-14(13)2)27(24,25)19-10-9-18(21)26-12-15-4-6-16(7-5-15)20(22)23/h3-8,11,19H,9-10,12H2,1-2H3.
What are the key properties of (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate?
(4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate has a molecular weight of 392.43 g/mol, XLogP of 2.62, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 3-[(3,4-dimethylphenyl)sulfonylamino]propanoate is sourced from PubChem (CID 9167143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).