About 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine
3,5-dimethyl-1-N-phenylbenzene-1,2-diamine (PubChem CID 91671728) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine |
| PubChem CID | 91671728 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine |
| SMILES | Cc1cc(C)c(N)c(Nc2ccccc2)c1 |
| InChI | InChI=1S/C14H16N2/c1-10-8-11(2)14(15)13(9-10)16-12-6-4-3-5-7-12/h3-9,16H,15H2,1-2H3 |
| InChIKey | INWCSEXYZPGJDD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine?
The IUPAC name of 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine (CID 91671728) is 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine.
What is the SMILES notation for 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine?
The canonical SMILES for 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine is Cc1cc(C)c(N)c(Nc2ccccc2)c1.
What is the InChIKey of 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine?
The InChIKey is INWCSEXYZPGJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-10-8-11(2)14(15)13(9-10)16-12-6-4-3-5-7-12/h3-9,16H,15H2,1-2H3.
What are the key properties of 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine?
3,5-dimethyl-1-N-phenylbenzene-1,2-diamine has a molecular weight of 212.30 g/mol, XLogP of 3.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-N-phenylbenzene-1,2-diamine is sourced from PubChem (CID 91671728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).