C18H19N3O3 — CID 91673334
(7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(3,5-dimethoxyphenyl)methanone (PubChem CID 91673334) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(3,5-dimethoxyphenyl)methanone.
| Compound Name | (7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 91673334 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN=Cc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-23-15-8-12(9-16(10-15)24-2)18(22)21-6-5-20-11-13-7-14(19)3-4-17(13)21/h3-4,7-11H,5-6,19H2,1-2H3 |
| InChIKey | UETYOTXARLOBIR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|