About 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole
2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole (PubChem CID 91673709) has the molecular formula C22H16N4O
and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole |
| PubChem CID | 91673709 |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole |
| SMILES | c1ccc(C(c2ccccc2)c2nc3ccc(-n4cnnc4)cc3o2)cc1 |
| InChI | InChI=1S/C22H16N4O/c1-3-7-16(8-4-1)21(17-9-5-2-6-10-17)22-25-19-12-11-18(13-20(19)27-22)26-14-23-24-15-26/h1-15,21H |
| InChIKey | KBHGZSFCFCPJGL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole?
The IUPAC name of 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole (CID 91673709) is 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole.
What is the SMILES notation for 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole?
The canonical SMILES for 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole is c1ccc(C(c2ccccc2)c2nc3ccc(-n4cnnc4)cc3o2)cc1.
What is the InChIKey of 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole?
The InChIKey is KBHGZSFCFCPJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O/c1-3-7-16(8-4-1)21(17-9-5-2-6-10-17)22-25-19-12-11-18(13-20(19)27-22)26-14-23-24-15-26/h1-15,21H.
What are the key properties of 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole?
2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole has a molecular weight of 352.40 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole is sourced from PubChem (CID 91673709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).