About 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine
2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine (PubChem CID 91675154) has the molecular formula C17H16N4O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine |
| PubChem CID | 91675154 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc(N)cc2nc(Cc3nc4cc(N)cc(C)c4o3)oc12 |
| InChI | InChI=1S/C17H16N4O2/c1-8-3-10(18)5-12-16(8)22-14(20-12)7-15-21-13-6-11(19)4-9(2)17(13)23-15/h3-6H,7,18-19H2,1-2H3 |
| InChIKey | DGXSIEVBMUMTAS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine?
The IUPAC name of 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine (CID 91675154) is 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine is Cc1cc(N)cc2nc(Cc3nc4cc(N)cc(C)c4o3)oc12.
What is the InChIKey of 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine?
The InChIKey is DGXSIEVBMUMTAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2/c1-8-3-10(18)5-12-16(8)22-14(20-12)7-15-21-13-6-11(19)4-9(2)17(13)23-15/h3-6H,7,18-19H2,1-2H3.
What are the key properties of 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine?
2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine has a molecular weight of 308.34 g/mol, XLogP of 3.34, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-7-methyl-1,3-benzoxazol-2-yl)methyl]-7-methyl-1,3-benzoxazol-5-amine is sourced from PubChem (CID 91675154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).