C22H20ClN5S — CID 91675226
6-[1-[(2-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-(3-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 91675226) has the molecular formula C22H20ClN5S and a molecular weight of 421.96 g/mol. Its IUPAC name is 6-[1-[(2-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-(3-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[1-[(2-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-(3-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 91675226 |
| Molecular Formula | C22H20ClN5S |
| Molecular Weight | 421.96 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 6-[1-[(2-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-(3-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cccc(-c2nnc3sc(C4=CCN(Cc5ccccc5Cl)CC4)nn23)c1 |
| InChI | InChI=1S/C22H20ClN5S/c1-15-5-4-7-17(13-15)20-24-25-22-28(20)26-21(29-22)16-9-11-27(12-10-16)14-18-6-2-3-8-19(18)23/h2-9,13H,10-12,14H2,1H3 |
| InChIKey | WABVLFKMSCVVBF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.96 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |