About 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole
2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole (PubChem CID 91675240) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole |
| PubChem CID | 91675240 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole |
| SMILES | CCCCN1CC=C(c2nc3cc(C)ccc3o2)CC1 |
| InChI | InChI=1S/C17H22N2O/c1-3-4-9-19-10-7-14(8-11-19)17-18-15-12-13(2)5-6-16(15)20-17/h5-7,12H,3-4,8-11H2,1-2H3 |
| InChIKey | WATJMGSFSRMWOU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole?
The IUPAC name of 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole (CID 91675240) is 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole.
What is the SMILES notation for 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole?
The canonical SMILES for 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole is CCCCN1CC=C(c2nc3cc(C)ccc3o2)CC1.
What is the InChIKey of 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole?
The InChIKey is WATJMGSFSRMWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-3-4-9-19-10-7-14(8-11-19)17-18-15-12-13(2)5-6-16(15)20-17/h5-7,12H,3-4,8-11H2,1-2H3.
What are the key properties of 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole?
2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole has a molecular weight of 270.38 g/mol, XLogP of 4.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butyl-3,6-dihydro-2H-pyridin-4-yl)-5-methyl-1,3-benzoxazole is sourced from PubChem (CID 91675240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).