C21H23N3O3 — CID 9167526
4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 9167526) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 9167526 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | C=CCOc1ccc(CN(C)CC(=O)N2CC(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-3-12-27-17-10-8-16(9-11-17)13-23(2)15-21(26)24-14-20(25)22-18-6-4-5-7-19(18)24/h3-11H,1,12-15H2,2H3,(H,22,25) |
| InChIKey | XDAOFQPBJKYCBD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|