About prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate
prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 91677294) has the molecular formula C15H15F3N2O3
and a molecular weight of 328.29 g/mol. Its IUPAC name is prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate |
| PubChem CID | 91677294 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | C#CCOC(=O)c1cc(N(C)C(=O)C(F)(F)F)ccc1N(C)C |
| InChI | InChI=1S/C15H15F3N2O3/c1-5-8-23-13(21)11-9-10(6-7-12(11)19(2)3)20(4)14(22)15(16,17)18/h1,6-7,9H,8H2,2-4H3 |
| InChIKey | JSUNHHFWXBRPMP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate?
The IUPAC name of prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate (CID 91677294) is prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate.
What is the SMILES notation for prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate?
The canonical SMILES for prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate is C#CCOC(=O)c1cc(N(C)C(=O)C(F)(F)F)ccc1N(C)C.
What is the InChIKey of prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate?
The InChIKey is JSUNHHFWXBRPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N2O3/c1-5-8-23-13(21)11-9-10(6-7-12(11)19(2)3)20(4)14(22)15(16,17)18/h1,6-7,9H,8H2,2-4H3.
What are the key properties of prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate?
prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate has a molecular weight of 328.29 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-(dimethylamino)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate is sourced from PubChem (CID 91677294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).