C13H3BrF5NS — CID 91678559
6-bromo-2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazole (PubChem CID 91678559) has the molecular formula C13H3BrF5NS and a molecular weight of 380.14 g/mol. Its IUPAC name is 6-bromo-2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazole.
| Compound Name | 6-bromo-2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 91678559 |
| Molecular Formula | C13H3BrF5NS |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 378.91 |
| IUPAC Name | 6-bromo-2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazole |
| SMILES | Fc1c(F)c(F)c(-c2nc3ccc(Br)cc3s2)c(F)c1F |
| InChI | InChI=1S/C13H3BrF5NS/c14-4-1-2-5-6(3-4)21-13(20-5)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
| InChIKey | HOGDCAKPNRPEGH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|