C12H3F5N2O — CID 91678562
2-(2,3,4,5,6-pentafluorophenyl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 91678562) has the molecular formula C12H3F5N2O and a molecular weight of 286.16 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 91678562 |
| Molecular Formula | C12H3F5N2O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | Fc1c(F)c(F)c(-c2nc3ncccc3o2)c(F)c1F |
| InChI | InChI=1S/C12H3F5N2O/c13-6-5(7(14)9(16)10(17)8(6)15)12-19-11-4(20-12)2-1-3-18-11/h1-3H |
| InChIKey | YQDVEJBGYGDMSK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|