C23H18N2O3 — CID 91678899
N-(2-anilino-1,3-dioxoinden-2-yl)-3-methylbenzamide (PubChem CID 91678899) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(2-anilino-1,3-dioxoinden-2-yl)-3-methylbenzamide.
| Compound Name | N-(2-anilino-1,3-dioxoinden-2-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 91678899 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(2-anilino-1,3-dioxoinden-2-yl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC2(Nc3ccccc3)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H18N2O3/c1-15-8-7-9-16(14-15)22(28)25-23(24-17-10-3-2-4-11-17)20(26)18-12-5-6-13-19(18)21(23)27/h2-14,24H,1H3,(H,25,28) |
| InChIKey | AVBOHDSTPNRXIY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|