C15H13N5O2 — CID 91678997
N-benzyl-4-nitro-2-(1,2,4-triazol-4-yl)aniline (PubChem CID 91678997) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-benzyl-4-nitro-2-(1,2,4-triazol-4-yl)aniline.
| Compound Name | N-benzyl-4-nitro-2-(1,2,4-triazol-4-yl)aniline |
|---|---|
| PubChem CID | 91678997 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-benzyl-4-nitro-2-(1,2,4-triazol-4-yl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccccc2)c(-n2cnnc2)c1 |
| InChI | InChI=1S/C15H13N5O2/c21-20(22)13-6-7-14(15(8-13)19-10-17-18-11-19)16-9-12-4-2-1-3-5-12/h1-8,10-11,16H,9H2 |
| InChIKey | KXKHWJOZLBXFCU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|