C5H8N6S — CID 91679130
(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)hydrazine (PubChem CID 91679130) has the molecular formula C5H8N6S and a molecular weight of 184.23 g/mol. Its IUPAC name is (3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)hydrazine.
| Compound Name | (3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)hydrazine |
|---|---|
| PubChem CID | 91679130 |
| Molecular Formula | C5H8N6S |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)hydrazine |
| SMILES | CCc1nnc2sc(NN)nn12 |
| InChI | InChI=1S/C5H8N6S/c1-2-3-8-9-5-11(3)10-4(7-6)12-5/h2,6H2,1H3,(H,7,10) |
| InChIKey | NQBCOTICQIWOBL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|