About 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine
6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine (PubChem CID 91679953) has the molecular formula C17H12N2OS
and a molecular weight of 292.36 g/mol. Its IUPAC name is 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine |
| PubChem CID | 91679953 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(Oc3cccc4ccccc34)cc2s1 |
| InChI | InChI=1S/C17H12N2OS/c18-17-19-14-9-8-12(10-16(14)21-17)20-15-7-3-5-11-4-1-2-6-13(11)15/h1-10H,(H2,18,19) |
| InChIKey | PSBUGUVXXAABPQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine?
The IUPAC name of 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine (CID 91679953) is 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine.
What is the SMILES notation for 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine?
The canonical SMILES for 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine is Nc1nc2ccc(Oc3cccc4ccccc34)cc2s1.
What is the InChIKey of 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine?
The InChIKey is PSBUGUVXXAABPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2OS/c18-17-19-14-9-8-12(10-16(14)21-17)20-15-7-3-5-11-4-1-2-6-13(11)15/h1-10H,(H2,18,19).
What are the key properties of 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine?
6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine has a molecular weight of 292.36 g/mol, XLogP of 4.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-naphthalen-1-yloxy-1,3-benzothiazol-2-amine is sourced from PubChem (CID 91679953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).