About N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide
N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide (PubChem CID 91680322) has the molecular formula C13H17N3OS
and a molecular weight of 263.37 g/mol. Its IUPAC name is N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide |
| PubChem CID | 91680322 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)cc2sc(N)nc12 |
| InChI | InChI=1S/C13H17N3OS/c1-7-5-8(15-11(17)13(2,3)4)6-9-10(7)16-12(14)18-9/h5-6H,1-4H3,(H2,14,16)(H,15,17) |
| InChIKey | VAGBOSCADNFMJA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide (CID 91680322) is N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide is Cc1cc(NC(=O)C(C)(C)C)cc2sc(N)nc12.
What is the InChIKey of N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide?
The InChIKey is VAGBOSCADNFMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3OS/c1-7-5-8(15-11(17)13(2,3)4)6-9-10(7)16-12(14)18-9/h5-6H,1-4H3,(H2,14,16)(H,15,17).
What are the key properties of N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide?
N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide has a molecular weight of 263.37 g/mol, XLogP of 3.17, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-4-methyl-1,3-benzothiazol-6-yl)-2,2-dimethylpropanamide is sourced from PubChem (CID 91680322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).