C21H26N2O2 — CID 9168111
2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 9168111) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 9168111 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | C=CCOc1ccc(CN(C)CC(=O)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-4-14-25-20-12-10-18(11-13-20)15-23(3)16-21(24)22-17(2)19-8-6-5-7-9-19/h4-13,17H,1,14-16H2,2-3H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | WBSFJZQAUNDOCN-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|