C12H16Br2N2 — CID 91681196
3,5-dibromo-4-(2-methylpiperidin-1-yl)aniline (PubChem CID 91681196) has the molecular formula C12H16Br2N2 and a molecular weight of 348.08 g/mol. Its IUPAC name is 3,5-dibromo-4-(2-methylpiperidin-1-yl)aniline.
| Compound Name | 3,5-dibromo-4-(2-methylpiperidin-1-yl)aniline |
|---|---|
| PubChem CID | 91681196 |
| Molecular Formula | C12H16Br2N2 |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 3,5-dibromo-4-(2-methylpiperidin-1-yl)aniline |
| SMILES | CC1CCCCN1c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C12H16Br2N2/c1-8-4-2-3-5-16(8)12-10(13)6-9(15)7-11(12)14/h6-8H,2-5,15H2,1H3 |
| InChIKey | XGNRYEQEUDGFAI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|