C16H13Cl3O3 — CID 91682734
ethyl 3,5-dichloro-4-[(2-chlorophenyl)methoxy]benzoate (PubChem CID 91682734) has the molecular formula C16H13Cl3O3 and a molecular weight of 359.64 g/mol. Its IUPAC name is ethyl 3,5-dichloro-4-[(2-chlorophenyl)methoxy]benzoate.
| Compound Name | ethyl 3,5-dichloro-4-[(2-chlorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 91682734 |
| Molecular Formula | C16H13Cl3O3 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | ethyl 3,5-dichloro-4-[(2-chlorophenyl)methoxy]benzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(OCc2ccccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl3O3/c1-2-21-16(20)11-7-13(18)15(14(19)8-11)22-9-10-5-3-4-6-12(10)17/h3-8H,2,9H2,1H3 |
| InChIKey | MSUQXJPTKGSGLZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |