About N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide
N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide (PubChem CID 91684052) has the molecular formula C21H26BrN3O
and a molecular weight of 416.36 g/mol. Its IUPAC name is N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide.
Molecular Properties
| Compound Name | N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide |
| PubChem CID | 91684052 |
| Molecular Formula | C21H26BrN3O |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide |
| SMILES | Cc1cc(N)c(NC(=O)c2ccccc2Br)cc1N1C(C)CCCC1C |
| InChI | InChI=1S/C21H26BrN3O/c1-13-11-18(23)19(24-21(26)16-9-4-5-10-17(16)22)12-20(13)25-14(2)7-6-8-15(25)3/h4-5,9-12,14-15H,6-8,23H2,1-3H3,(H,24,26) |
| InChIKey | QSUCHTZQTKEHGA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide?
The IUPAC name of N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide (CID 91684052) is N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide.
What is the SMILES notation for N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide?
The canonical SMILES for N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide is Cc1cc(N)c(NC(=O)c2ccccc2Br)cc1N1C(C)CCCC1C.
What is the InChIKey of N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide?
The InChIKey is QSUCHTZQTKEHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26BrN3O/c1-13-11-18(23)19(24-21(26)16-9-4-5-10-17(16)22)12-20(13)25-14(2)7-6-8-15(25)3/h4-5,9-12,14-15H,6-8,23H2,1-3H3,(H,24,26).
What are the key properties of N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide?
N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide has a molecular weight of 416.36 g/mol, XLogP of 5.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-amino-5-(2,6-dimethylpiperidin-1-yl)-4-methylphenyl]-2-bromobenzamide is sourced from PubChem (CID 91684052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).