About 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine (PubChem CID 91684228) has the molecular formula C14H11FN4O2
and a molecular weight of 286.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine |
| PubChem CID | 91684228 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine |
| SMILES | Nc1cc2nn(-c3ccc4c(c3)OCCO4)nc2cc1F |
| InChI | InChI=1S/C14H11FN4O2/c15-9-6-11-12(7-10(9)16)18-19(17-11)8-1-2-13-14(5-8)21-4-3-20-13/h1-2,5-7H,3-4,16H2 |
| InChIKey | UWHQZFGXVHDDHH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine?
The IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine (CID 91684228) is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine.
What is the SMILES notation for 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine?
The canonical SMILES for 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine is Nc1cc2nn(-c3ccc4c(c3)OCCO4)nc2cc1F.
What is the InChIKey of 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine?
The InChIKey is UWHQZFGXVHDDHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN4O2/c15-9-6-11-12(7-10(9)16)18-19(17-11)8-1-2-13-14(5-8)21-4-3-20-13/h1-2,5-7H,3-4,16H2.
What are the key properties of 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine?
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine has a molecular weight of 286.27 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluorobenzotriazol-5-amine is sourced from PubChem (CID 91684228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).