C13H22N2+2 — CID 9168635
diethyl-[(4S)-1,2,3,4-tetrahydroisoquinolin-2-ium-4-yl]azanium (PubChem CID 9168635) has the molecular formula C13H22N2+2 and a molecular weight of 206.33 g/mol. Its IUPAC name is diethyl-[(4S)-1,2,3,4-tetrahydroisoquinolin-2-ium-4-yl]azanium.
| Compound Name | diethyl-[(4S)-1,2,3,4-tetrahydroisoquinolin-2-ium-4-yl]azanium |
|---|---|
| PubChem CID | 9168635 |
| Molecular Formula | C13H22N2+2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | diethyl-[(4S)-1,2,3,4-tetrahydroisoquinolin-2-ium-4-yl]azanium |
| SMILES | CC[NH+](CC)[C@@H]1C[NH2+]Cc2ccccc21 |
| InChI | InChI=1S/C13H20N2/c1-3-15(4-2)13-10-14-9-11-7-5-6-8-12(11)13/h5-8,13-14H,3-4,9-10H2,1-2H3/p+2/t13-/m1/s1 |
| InChIKey | BIIIFPBHTGUANM-CYBMUJFWSA-P |
| XLogP | -0.27 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |