About 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid
7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid (PubChem CID 91686806) has the molecular formula C14H7BrCl2N2O2
and a molecular weight of 386.03 g/mol. Its IUPAC name is 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid |
| PubChem CID | 91686806 |
| Molecular Formula | C14H7BrCl2N2O2 |
| Molecular Weight | 386.03 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(Br)c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C14H7BrCl2N2O2/c15-8-3-7(14(20)21)5-11-12(8)19-13(18-11)6-1-2-9(16)10(17)4-6/h1-5H,(H,18,19)(H,20,21) |
| InChIKey | MDXQETUFNKZVNA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid?
The IUPAC name of 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid (CID 91686806) is 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid.
What is the SMILES notation for 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid?
The canonical SMILES for 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid is O=C(O)c1cc(Br)c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1.
What is the InChIKey of 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid?
The InChIKey is MDXQETUFNKZVNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7BrCl2N2O2/c15-8-3-7(14(20)21)5-11-12(8)19-13(18-11)6-1-2-9(16)10(17)4-6/h1-5H,(H,18,19)(H,20,21).
What are the key properties of 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid?
7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid has a molecular weight of 386.03 g/mol, XLogP of 5.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylic acid is sourced from PubChem (CID 91686806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).