C12H9Cl2NO4 — CID 91687047
prop-2-enyl (E)-3-(3,4-dichloro-5-nitrophenyl)prop-2-enoate (PubChem CID 91687047) has the molecular formula C12H9Cl2NO4 and a molecular weight of 302.11 g/mol. Its IUPAC name is prop-2-enyl (E)-3-(3,4-dichloro-5-nitrophenyl)prop-2-enoate.
| Compound Name | prop-2-enyl (E)-3-(3,4-dichloro-5-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91687047 |
| Molecular Formula | C12H9Cl2NO4 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | prop-2-enyl (E)-3-(3,4-dichloro-5-nitrophenyl)prop-2-enoate |
| SMILES | C=CCOC(=O)/C=C/c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9Cl2NO4/c1-2-5-19-11(16)4-3-8-6-9(13)12(14)10(7-8)15(17)18/h2-4,6-7H,1,5H2/b4-3+ |
| InChIKey | HJWACJNGMLNJFR-ONEGZZNKSA-N |
| XLogP | 3.64 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|