C8H12N6S — CID 91687144
3-ethyl-N-(propan-2-ylideneamino)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine (PubChem CID 91687144) has the molecular formula C8H12N6S and a molecular weight of 224.29 g/mol. Its IUPAC name is 3-ethyl-N-(propan-2-ylideneamino)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine.
| Compound Name | 3-ethyl-N-(propan-2-ylideneamino)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
|---|---|
| PubChem CID | 91687144 |
| Molecular Formula | C8H12N6S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-ethyl-N-(propan-2-ylideneamino)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
| SMILES | CCc1nnc2sc(NN=C(C)C)nn12 |
| InChI | InChI=1S/C8H12N6S/c1-4-6-10-12-8-14(6)13-7(15-8)11-9-5(2)3/h4H2,1-3H3,(H,11,13) |
| InChIKey | DXQCSFZARXAPDB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|