C20H10Cl2N2O2 — CID 91689506
1-[5-(3,5-dichlorophenyl)furan-2-carbonyl]indole-3-carbonitrile (PubChem CID 91689506) has the molecular formula C20H10Cl2N2O2 and a molecular weight of 381.22 g/mol. Its IUPAC name is 1-[5-(3,5-dichlorophenyl)furan-2-carbonyl]indole-3-carbonitrile.
| Compound Name | 1-[5-(3,5-dichlorophenyl)furan-2-carbonyl]indole-3-carbonitrile |
|---|---|
| PubChem CID | 91689506 |
| Molecular Formula | C20H10Cl2N2O2 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 1-[5-(3,5-dichlorophenyl)furan-2-carbonyl]indole-3-carbonitrile |
| SMILES | N#Cc1cn(C(=O)c2ccc(-c3cc(Cl)cc(Cl)c3)o2)c2ccccc12 |
| InChI | InChI=1S/C20H10Cl2N2O2/c21-14-7-12(8-15(22)9-14)18-5-6-19(26-18)20(25)24-11-13(10-23)16-3-1-2-4-17(16)24/h1-9,11H |
| InChIKey | URBSQIWLNWDAFC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 58.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |