C17H14ClNO4 — CID 91690018
[4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 91690018) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 91690018 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=C/C(N)=O)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO4/c1-22-15-10-11(3-9-16(19)20)2-8-14(15)23-17(21)12-4-6-13(18)7-5-12/h2-10H,1H3,(H2,19,20)/b9-3+ |
| InChIKey | BTVPBXDZSWARSC-YCRREMRBSA-N |
| XLogP | 3.07 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|