C16H9Cl2NO2 — CID 91690489
1-(3,4-dichlorobenzoyl)indole-3-carbaldehyde (PubChem CID 91690489) has the molecular formula C16H9Cl2NO2 and a molecular weight of 318.16 g/mol. Its IUPAC name is 1-(3,4-dichlorobenzoyl)indole-3-carbaldehyde.
| Compound Name | 1-(3,4-dichlorobenzoyl)indole-3-carbaldehyde |
|---|---|
| PubChem CID | 91690489 |
| Molecular Formula | C16H9Cl2NO2 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 1-(3,4-dichlorobenzoyl)indole-3-carbaldehyde |
| SMILES | O=Cc1cn(C(=O)c2ccc(Cl)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C16H9Cl2NO2/c17-13-6-5-10(7-14(13)18)16(21)19-8-11(9-20)12-3-1-2-4-15(12)19/h1-9H |
| InChIKey | CINWTKSOYYLWHK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|