About (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene
(E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene (PubChem CID 91691162) has the molecular formula C3H2F4O3S
and a molecular weight of 194.11 g/mol. Its IUPAC name is (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene.
Molecular Properties
| Compound Name | (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene |
| PubChem CID | 91691162 |
| Molecular Formula | C3H2F4O3S |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene |
| SMILES | O=S(=O)(F)O/C=C/C(F)(F)F |
| InChI | InChI=1S/C3H2F4O3S/c4-3(5,6)1-2-10-11(7,8)9/h1-2H/b2-1+ |
| InChIKey | RYYZNVMDLILOCK-OWOJBTEDSA-N |
| XLogP | 1.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene?
The IUPAC name of (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene (CID 91691162) is (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene.
What is the SMILES notation for (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene?
The canonical SMILES for (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene is O=S(=O)(F)O/C=C/C(F)(F)F.
What is the InChIKey of (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene?
The InChIKey is RYYZNVMDLILOCK-OWOJBTEDSA-N. The full InChI is InChI=1S/C3H2F4O3S/c4-3(5,6)1-2-10-11(7,8)9/h1-2H/b2-1+.
What are the key properties of (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene?
(E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene has a molecular weight of 194.11 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,3,3-trifluoro-1-fluorosulfonyloxyprop-1-ene is sourced from PubChem (CID 91691162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).