C14H21F5O4 — CID 91691350
1-O-(4-methylpentyl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-dimethylpropanedioate (PubChem CID 91691350) has the molecular formula C14H21F5O4 and a molecular weight of 348.31 g/mol. Its IUPAC name is 1-O-(4-methylpentyl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-dimethylpropanedioate.
| Compound Name | 1-O-(4-methylpentyl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 91691350 |
| Molecular Formula | C14H21F5O4 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-O-(4-methylpentyl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-dimethylpropanedioate |
| SMILES | CC(C)CCCOC(=O)C(C)(C)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H21F5O4/c1-9(2)6-5-7-22-10(20)12(3,4)11(21)23-8-13(15,16)14(17,18)19/h9H,5-8H2,1-4H3 |
| InChIKey | HWDZIYZJDBYSPA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|