About 3-acetyl-6-ethoxyoxane-2,4-dione
3-acetyl-6-ethoxyoxane-2,4-dione (PubChem CID 91691394) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-acetyl-6-ethoxyoxane-2,4-dione.
Molecular Properties
| Compound Name | 3-acetyl-6-ethoxyoxane-2,4-dione |
| PubChem CID | 91691394 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3-acetyl-6-ethoxyoxane-2,4-dione |
| SMILES | CCOC1CC(=O)C(C(C)=O)C(=O)O1 |
| InChI | InChI=1S/C9H12O5/c1-3-13-7-4-6(11)8(5(2)10)9(12)14-7/h7-8H,3-4H2,1-2H3 |
| InChIKey | HCNHDWKSCFVPBY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-6-ethoxyoxane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-6-ethoxyoxane-2,4-dione?
The IUPAC name of 3-acetyl-6-ethoxyoxane-2,4-dione (CID 91691394) is 3-acetyl-6-ethoxyoxane-2,4-dione.
What is the SMILES notation for 3-acetyl-6-ethoxyoxane-2,4-dione?
The canonical SMILES for 3-acetyl-6-ethoxyoxane-2,4-dione is CCOC1CC(=O)C(C(C)=O)C(=O)O1.
What is the InChIKey of 3-acetyl-6-ethoxyoxane-2,4-dione?
The InChIKey is HCNHDWKSCFVPBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5/c1-3-13-7-4-6(11)8(5(2)10)9(12)14-7/h7-8H,3-4H2,1-2H3.
What are the key properties of 3-acetyl-6-ethoxyoxane-2,4-dione?
3-acetyl-6-ethoxyoxane-2,4-dione has a molecular weight of 200.19 g/mol, XLogP of 0.07, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-6-ethoxyoxane-2,4-dione is sourced from PubChem (CID 91691394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).