C16H12F12O10 — CID 91691555
propan-2-yl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate (PubChem CID 91691555) has the molecular formula C16H12F12O10 and a molecular weight of 592.24 g/mol. Its IUPAC name is propan-2-yl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate.
| Compound Name | propan-2-yl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate |
|---|---|
| PubChem CID | 91691555 |
| Molecular Formula | C16H12F12O10 |
| Molecular Weight | 592.24 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | propan-2-yl 2,3,4,5-tetrakis[(2,2,2-trifluoroacetyl)oxy]pentanoate |
| SMILES | CC(C)OC(=O)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H12F12O10/c1-4(2)35-8(29)7(38-12(33)16(26,27)28)6(37-11(32)15(23,24)25)5(36-10(31)14(20,21)22)3-34-9(30)13(17,18)19/h4-7H,3H2,1-2H3 |
| InChIKey | DMWNYRXEZBJGPT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|