C12H11F9N2O4 — CID 91691560
N-acetyl-N-[4-[bis(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide (PubChem CID 91691560) has the molecular formula C12H11F9N2O4 and a molecular weight of 418.21 g/mol. Its IUPAC name is N-acetyl-N-[4-[bis(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-acetyl-N-[4-[bis(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91691560 |
| Molecular Formula | C12H11F9N2O4 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-acetyl-N-[4-[bis(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)N(CCCCN(C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F9N2O4/c1-6(24)22(7(25)10(13,14)15)4-2-3-5-23(8(26)11(16,17)18)9(27)12(19,20)21/h2-5H2,1H3 |
| InChIKey | JZKXRPRMKKTRCI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|