C19H13F15O12 — CID 91691572
propan-2-yl 2,3,4,5,6-pentakis[(2,2,2-trifluoroacetyl)oxy]hexanoate (PubChem CID 91691572) has the molecular formula C19H13F15O12 and a molecular weight of 718.27 g/mol. Its IUPAC name is propan-2-yl 2,3,4,5,6-pentakis[(2,2,2-trifluoroacetyl)oxy]hexanoate.
| Compound Name | propan-2-yl 2,3,4,5,6-pentakis[(2,2,2-trifluoroacetyl)oxy]hexanoate |
|---|---|
| PubChem CID | 91691572 |
| Molecular Formula | C19H13F15O12 |
| Molecular Weight | 718.27 g/mol |
| Exact Mass | 718.02 |
| IUPAC Name | propan-2-yl 2,3,4,5,6-pentakis[(2,2,2-trifluoroacetyl)oxy]hexanoate |
| SMILES | CC(C)OC(=O)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H13F15O12/c1-4(2)42-9(35)8(46-14(40)19(32,33)34)7(45-13(39)18(29,30)31)6(44-12(38)17(26,27)28)5(43-11(37)16(23,24)25)3-41-10(36)15(20,21)22/h4-8H,3H2,1-2H3 |
| InChIKey | IOHDVVXTOJCEEC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|