C9H13F5O2 — CID 91691592
2-ethylbutyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91691592) has the molecular formula C9H13F5O2 and a molecular weight of 248.19 g/mol. Its IUPAC name is 2-ethylbutyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-ethylbutyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91691592 |
| Molecular Formula | C9H13F5O2 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-ethylbutyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCC(CC)COC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O2/c1-3-6(4-2)5-16-7(15)8(10,11)9(12,13)14/h6H,3-5H2,1-2H3 |
| InChIKey | QAQCNYKZZWYKAB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|