C21H36O8 — CID 91691626
bis[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 2,2-diethylpropanedioate (PubChem CID 91691626) has the molecular formula C21H36O8 and a molecular weight of 416.51 g/mol. Its IUPAC name is bis[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 2,2-diethylpropanedioate.
| Compound Name | bis[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91691626 |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | bis[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OCCC1COC(C)(C)O1)C(=O)OCCC1COC(C)(C)O1 |
| InChI | InChI=1S/C21H36O8/c1-7-21(8-2,17(22)24-11-9-15-13-26-19(3,4)28-15)18(23)25-12-10-16-14-27-20(5,6)29-16/h15-16H,7-14H2,1-6H3 |
| InChIKey | IYKBQWFRUJKQLI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|