About 4-methylpentyl 3-hydroxy-2-methylidenebutanoate
4-methylpentyl 3-hydroxy-2-methylidenebutanoate (PubChem CID 91691688) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 4-methylpentyl 3-hydroxy-2-methylidenebutanoate.
Molecular Properties
| Compound Name | 4-methylpentyl 3-hydroxy-2-methylidenebutanoate |
| PubChem CID | 91691688 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 4-methylpentyl 3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCCCC(C)C)C(C)O |
| InChI | InChI=1S/C11H20O3/c1-8(2)6-5-7-14-11(13)9(3)10(4)12/h8,10,12H,3,5-7H2,1-2,4H3 |
| InChIKey | HLNKZECEKFRDQV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentyl 3-hydroxy-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentyl 3-hydroxy-2-methylidenebutanoate?
The IUPAC name of 4-methylpentyl 3-hydroxy-2-methylidenebutanoate (CID 91691688) is 4-methylpentyl 3-hydroxy-2-methylidenebutanoate.
What is the SMILES notation for 4-methylpentyl 3-hydroxy-2-methylidenebutanoate?
The canonical SMILES for 4-methylpentyl 3-hydroxy-2-methylidenebutanoate is C=C(C(=O)OCCCC(C)C)C(C)O.
What is the InChIKey of 4-methylpentyl 3-hydroxy-2-methylidenebutanoate?
The InChIKey is HLNKZECEKFRDQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-8(2)6-5-7-14-11(13)9(3)10(4)12/h8,10,12H,3,5-7H2,1-2,4H3.
What are the key properties of 4-methylpentyl 3-hydroxy-2-methylidenebutanoate?
4-methylpentyl 3-hydroxy-2-methylidenebutanoate has a molecular weight of 200.28 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 3-hydroxy-2-methylidenebutanoate is sourced from PubChem (CID 91691688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).