C24H26O9S — CID 91691924
[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate (PubChem CID 91691924) has the molecular formula C24H26O9S and a molecular weight of 490.53 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91691924 |
| Molecular Formula | C24H26O9S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](Sc2ccc3ccccc3c2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H26O9S/c1-13(25)29-12-20-21(30-14(2)26)22(31-15(3)27)23(32-16(4)28)24(33-20)34-19-10-9-17-7-5-6-8-18(17)11-19/h5-11,20-24H,12H2,1-4H3/t20-,21+,22-,23-,24-/m0/s1 |
| InChIKey | ATJSIKOSXMUARL-HTUFRPJOSA-N |
| XLogP | 3.02 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|