C18H33NO4 — CID 91691973
hexyl 2-(hexoxycarbonylamino)pent-4-enoate (PubChem CID 91691973) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is hexyl 2-(hexoxycarbonylamino)pent-4-enoate.
| Compound Name | hexyl 2-(hexoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91691973 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | hexyl 2-(hexoxycarbonylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)OCCCCCC)C(=O)OCCCCCC |
| InChI | InChI=1S/C18H33NO4/c1-4-7-9-11-14-22-17(20)16(13-6-3)19-18(21)23-15-12-10-8-5-2/h6,16H,3-5,7-15H2,1-2H3,(H,19,21) |
| InChIKey | JCMGOMLZDMPTJC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|