C16H26BrF3O4 — CID 91692065
1-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 3-O-hexyl 2,2-diethylpropanedioate (PubChem CID 91692065) has the molecular formula C16H26BrF3O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is 1-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 3-O-hexyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 3-O-hexyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91692065 |
| Molecular Formula | C16H26BrF3O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 3-O-hexyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCOC(=O)C(CC)(CC)C(=O)OC(CBr)C(F)(F)F |
| InChI | InChI=1S/C16H26BrF3O4/c1-4-7-8-9-10-23-13(21)15(5-2,6-3)14(22)24-12(11-17)16(18,19)20/h12H,4-11H2,1-3H3 |
| InChIKey | UHXGBDATXMOSQN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|