C11H13F5O6 — CID 91692074
[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91692074) has the molecular formula C11H13F5O6 and a molecular weight of 336.21 g/mol. Its IUPAC name is [1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91692074 |
| Molecular Formula | C11H13F5O6 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | COC(=O)C(OC(=O)C(F)(F)C(F)(F)F)C1COC(C)(C)O1 |
| InChI | InChI=1S/C11H13F5O6/c1-9(2)20-4-5(22-9)6(7(17)19-3)21-8(18)10(12,13)11(14,15)16/h5-6H,4H2,1-3H3 |
| InChIKey | WLYZJXRFMKLTAT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|