C18H26F8O4 — CID 91692082
1-O-hexyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate (PubChem CID 91692082) has the molecular formula C18H26F8O4 and a molecular weight of 458.39 g/mol. Its IUPAC name is 1-O-hexyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate.
| Compound Name | 1-O-hexyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91692082 |
| Molecular Formula | C18H26F8O4 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-O-hexyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate |
| SMILES | CCCCCCOC(=O)C(CC)(CC)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H26F8O4/c1-4-7-8-9-10-29-13(27)15(5-2,6-3)14(28)30-11-16(21,22)18(25,26)17(23,24)12(19)20/h12H,4-11H2,1-3H3 |
| InChIKey | QJZLXYBPDZMJBW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|