C12H13F7O6 — CID 91692096
[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91692096) has the molecular formula C12H13F7O6 and a molecular weight of 386.22 g/mol. Its IUPAC name is [1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91692096 |
| Molecular Formula | C12H13F7O6 |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-2-oxoethyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | COC(=O)C(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C1COC(C)(C)O1 |
| InChI | InChI=1S/C12H13F7O6/c1-9(2)23-4-5(25-9)6(7(20)22-3)24-8(21)10(13,14)11(15,16)12(17,18)19/h5-6H,4H2,1-3H3 |
| InChIKey | AFSJEBKYKZHXGI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|