C17H24F8O5 — CID 91692302
1-O-(5-methoxy-3-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91692302) has the molecular formula C17H24F8O5 and a molecular weight of 460.36 g/mol. Its IUPAC name is 1-O-(5-methoxy-3-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-(5-methoxy-3-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91692302 |
| Molecular Formula | C17H24F8O5 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 1-O-(5-methoxy-3-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | COCCC(C)CCOC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H24F8O5/c1-11(6-8-28-2)7-9-29-12(26)4-3-5-13(27)30-10-15(20,21)17(24,25)16(22,23)14(18)19/h11,14H,3-10H2,1-2H3 |
| InChIKey | XYQDKRCOUFSFAD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|