C9H15F3O2 — CID 91692532
2,3-dimethylpentan-3-yl 2,2,2-trifluoroacetate (PubChem CID 91692532) has the molecular formula C9H15F3O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2,3-dimethylpentan-3-yl 2,2,2-trifluoroacetate.
| Compound Name | 2,3-dimethylpentan-3-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91692532 |
| Molecular Formula | C9H15F3O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2,3-dimethylpentan-3-yl 2,2,2-trifluoroacetate |
| SMILES | CCC(C)(OC(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H15F3O2/c1-5-8(4,6(2)3)14-7(13)9(10,11)12/h6H,5H2,1-4H3 |
| InChIKey | FGUDSLOZQAIXRF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |