C13H17F7O2 — CID 91692603
2,2,3,3,4,4,4-heptafluorobutyl 3-cyclohexylpropanoate (PubChem CID 91692603) has the molecular formula C13H17F7O2 and a molecular weight of 338.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 3-cyclohexylpropanoate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 91692603 |
| Molecular Formula | C13H17F7O2 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 3-cyclohexylpropanoate |
| SMILES | O=C(CCC1CCCCC1)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F7O2/c14-11(15,12(16,17)13(18,19)20)8-22-10(21)7-6-9-4-2-1-3-5-9/h9H,1-8H2 |
| InChIKey | KYNRZQAAOJKLQQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|